Bz-Nle-Lys-Arg-Arg-AMC trifluoroacetate salt structure
|
Common Name | Bz-Nle-Lys-Arg-Arg-AMC trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 863975-32-0 | Molecular Weight | 832.99100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C41H60N12O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bz-Nle-Lys-Arg-Arg-AMC trifluoroacetate saltBz-Nle-Lys-Arg-Arg-AMC is a substrate for dengue virus NS2B-NS3 and yellow fever virus NS3 protease. |
| Name | Bz-Nle-Lys-Arg-Arg-AMC |
|---|
| Molecular Formula | C41H60N12O7 |
|---|---|
| Molecular Weight | 832.99100 |
| Exact Mass | 832.47100 |
| PSA | 325.53000 |
| LogP | 5.85740 |
| InChIKey | OLWZMHHMCMSOQU-YDPTYEFTSA-N |
| SMILES | CCCCC(NC(=O)c1ccccc1)C(=O)NC(CCCCN)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)Nc1ccc2c(C)cc(=O)oc2c1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |