Ganoderic acid Y
Modify Date: 2025-08-27 06:38:26
Ganoderic acid Y structure
|
Common Name | Ganoderic acid Y | ||
|---|---|---|---|---|
| CAS Number | 86377-52-8 | Molecular Weight | 454.68400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H46O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ganoderic acid YGanoderic acid Y is a α-glucosidase inhibitor with an IC50 of 170 μM for yeast α-glucosidase. Ganoderic acid Y inhibits enterovirus 71 (EV71) replication through blocking EV71 uncoating[1][2]. |
| Name | 3β-hydroxy-5α-lanosta-7,9,24(E)-trien-26-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Ganoderic acid Y is a α-glucosidase inhibitor with an IC50 of 170 μM for yeast α-glucosidase. Ganoderic acid Y inhibits enterovirus 71 (EV71) replication through blocking EV71 uncoating[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Ganoderic acid Y significantly inhibits the replication of the viral RNA (vRNA) of EV71[2]. |
| References |
| Molecular Formula | C30H46O3 |
|---|---|
| Molecular Weight | 454.68400 |
| Exact Mass | 454.34500 |
| PSA | 57.53000 |
| LogP | 7.31980 |
| InChIKey | HUTCYUJPLOTDMX-SPPZYOJVSA-N |
| SMILES | CC(=CCCC(C)C1CCC2(C)C3=CCC4C(C)(CCC(O)C4(C)C)C3=CCC12C)C(=O)O |
| Hazard Codes | Xi |
|---|
| (E)-(R)-6-((3S,5R,10S,13R,14R,17R)-3-Hydroxy-4,4,10,13,14-pentamethyl-2,3,4,5,6,10,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyl-hept-2-enoic acid |
| acide ganoderique Y |
| ganoderic acid Y |