1H-Indazole-5-boronic Acid Pinacol Ester structure
|
Common Name | 1H-Indazole-5-boronic Acid Pinacol Ester | ||
|---|---|---|---|---|
| CAS Number | 862723-42-0 | Molecular Weight | 244.097 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 404.1±18.0 °C at 760 mmHg | |
| Molecular Formula | C13H17BN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.2±21.2 °C | |
| Name | 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 404.1±18.0 °C at 760 mmHg |
| Molecular Formula | C13H17BN2O2 |
| Molecular Weight | 244.097 |
| Flash Point | 198.2±21.2 °C |
| Exact Mass | 244.138306 |
| PSA | 47.14000 |
| LogP | 1.86210 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | SAGPUUKLGWNGOS-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2ccc3[nH]ncc3c2)OC1(C)C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37 |
| HS Code | 2933990090 |
|
~82%
1H-Indazole-5-b... CAS#:862723-42-0 |
| Literature: WO2009/67586 A1, ; Page/Page column 42 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indazole, 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- |
| 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| 1H-Indazole-5-boronic acid pinacol ester |