Bis(pinacolato)diboron structure
|
Common Name | Bis(pinacolato)diboron | ||
|---|---|---|---|---|
| CAS Number | 73183-34-3 | Molecular Weight | 253.94 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 222.6±7.0 °C at 760 mmHg | |
| Molecular Formula | C12H24B2O4 | Melting Point | 137-140 °C(lit.) | |
| MSDS | N/A | Flash Point | 88.4±18.2 °C | |
Use of Bis(pinacolato)diboronBis(pinacolato)diborane is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | Bis(pinacolato)diboron |
|---|---|
| Synonym | More Synonyms |
| Description | Bis(pinacolato)diborane is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 222.6±7.0 °C at 760 mmHg |
| Melting Point | 137-140 °C(lit.) |
| Molecular Formula | C12H24B2O4 |
| Molecular Weight | 253.94 |
| Flash Point | 88.4±18.2 °C |
| Exact Mass | 254.186066 |
| PSA | 36.92000 |
| LogP | 2.24920 |
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
| Index of Refraction | 1.432 |
| InChIKey | IPWKHHSGDUIRAH-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| Storage condition | 0-6°C |
| Hazard Codes | Xi:Irritant |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Bis(pinacolate)diboron |
| Bis-(Pinacolato) Boron |
| Bis(pinacolato)diboron |
| 4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-4',4',5',5'-tetramethyl-1,3,2-dioxaborolane |
| MFCD00799570 |
| BIS(PINACALATO)DIBORON |
| Bis (pinacoloto)diboron |
| B2Pin2 |
| 4,4,4',4',5,5,5',5'-Octamethyl-2,2'-bi-1,3,2-dioxaborolane |
| T5OBOTJ D1 D1 E1 E1 B- BT5OBOTJ D1 D1 E1 E1 |
| 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydroisoquinolin-1(2H)-one |
| BIS(PINACOLATO)DIBORANE |
| Pin2B2 |
| DIBORON PINACOL ESTER |
| 4,4,4',4',5,5,5',5'-Octamethyl-2,2'-bi(1,3,2-dioxaborolane) |
| 4,4,5,5-tetramethyl-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
| 2,2'-Bi-1,3,2-dioxaborolane, 4,4,4',4',5,5,5',5'-octamethyl- |
| 4,4,5,5-tetramethyl-2-(4,4,5,5 tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
| BIS(DINACOLATO)DIBORON |