Fmoc-Ala-OPfp structure
|
Common Name | Fmoc-Ala-OPfp | ||
|---|---|---|---|---|
| CAS Number | 86060-86-8 | Molecular Weight | 477.38000 | |
| Density | 1.426±0.06 g/cm3(Predicted) | Boiling Point | 574.1±50.0 °C(Predicted) | |
| Molecular Formula | C24H16F5NO4 | Melting Point | 181.0 to 185.0 °C | |
| MSDS | USA | Flash Point | N/A | |
Use of Fmoc-Ala-OPfpFmoc-Ala-Opfp is an alanine derivative[1]. |
| Name | (2,3,4,5,6-pentafluorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-Ala-Opfp is an alanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.426±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 574.1±50.0 °C(Predicted) |
| Melting Point | 181.0 to 185.0 °C |
| Molecular Formula | C24H16F5NO4 |
| Molecular Weight | 477.38000 |
| Exact Mass | 477.10000 |
| PSA | 64.63000 |
| LogP | 5.60560 |
| InChIKey | CJXZXBGKOSXBFR-NSHDSACASA-N |
| SMILES | CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| Storage condition | 2-8°C |
|
~91%
Fmoc-Ala-OPfp CAS#:86060-86-8 |
| Literature: Jacobsen, Mogens Havsteen; Buchardt, Ole; Engdahl, Tom; Holm, Arne Tetrahedron Letters, 1991 , vol. 32, # 43 p. 6199 - 6202 |
|
~95%
Fmoc-Ala-OPfp CAS#:86060-86-8 |
| Literature: Kisfaludy, Lajos; Schoen, Istvan Synthesis, 1983 , # 4 p. 325 - 327 |
|
~%
Fmoc-Ala-OPfp CAS#:86060-86-8 |
| Literature: Tetrahedron Letters, , vol. 32, # 43 p. 6199 - 6202 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (9H-fluoren-9-yl-methoxy)carbonyl-L-alanine pentafluorophenyl ester |
| 9-fluorenylmethyloxycarbonyl-L-alanine pentafluorophenyl ester |
| Fmoc-Ala-OPfp |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanine Pentafluorophenyl Ester |
| Fmoc-L-alanine pentafluorophenyl ester |
| N-Fmoc-L-alanine pentaflurophenyl ester |
| Fmoc-Ala-OPf |
| MFCD00065612 |
| Fmoc-Ala pentafluorophenyl ester |