3-chloro-N-(4-cyclopentylphenyl)propanamide structure
|
Common Name | 3-chloro-N-(4-cyclopentylphenyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 85603-07-2 | Molecular Weight | 251.75200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-N-(4-cyclopentylphenyl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18ClNO |
|---|---|
| Molecular Weight | 251.75200 |
| Exact Mass | 251.10800 |
| PSA | 29.10000 |
| LogP | 3.98460 |
| InChIKey | HXCHRSYAERJLFI-UHFFFAOYSA-N |
| SMILES | O=C(CCCl)Nc1ccc(C2CCCC2)cc1 |
|
~97%
3-chloro-N-(4-c... CAS#:85603-07-2 |
| Literature: Vejdelek; Bartosova; Protiva Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 1 p. 156 - 162 |
|
~%
3-chloro-N-(4-c... CAS#:85603-07-2 |
| Literature: Vejdelek; Bartosova; Protiva Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 1 p. 156 - 162 |
| Propanamide,3-chloro-N-(4-cyclopentylphenyl) |
| N-(4-cyclopentylphenyl)-3-chloropropionamide |