3-chloro-N-(4-fluorophenyl)propanamide
Modify Date: 2024-01-03 01:04:29
3-chloro-N-(4-fluorophenyl)propanamide structure
|
Common Name | 3-chloro-N-(4-fluorophenyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 56767-37-4 | Molecular Weight | 178.185 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 342.6±17.0 °C at 760 mmHg | |
| Molecular Formula | C10H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.6±14.4 °C | |
| Name | 3-chloro-N-(4-fluorophenyl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 342.6±17.0 °C at 760 mmHg |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.185 |
| Flash Point | 138.6±14.4 °C |
| Exact Mass | 178.062988 |
| PSA | 29.10000 |
| LogP | 2.36 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.591 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Cinnamic acid,4-methoxy-,cis |
| EINECS 227-137-0 |
| F9995-0371 |
| (2Z)-3-(4-methoxyphenyl)prop-2-enoic acid |
| (2Z)-3-(4-Methoxyphenyl)acrylic acid |
| (Z)-p-Methoxycinnamic acid |
| N-(4-Fluorophenyl)-3-chloropropanamide |
| Propanamide,N-(4-fluorophenyl)-3-chloro |
| (Z)-3-(4-Methoxyphenyl)acrylic acid |
| 2-Propenoic acid,3-(4-methoxyphenyl)-,(2Z) |
| 2-Propenoic acid, 3-(4-methoxyphenyl)-, (2Z)- |