Zomepirac-d4 sodium salt structure
|
Common Name | Zomepirac-d4 sodium salt | ||
|---|---|---|---|---|
| CAS Number | 85577-28-2 | Molecular Weight | 317.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10D4ClNNaO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Zomepirac-d4 sodium saltZomepirac-d4 sodium salt is the deuterium labeled Zomepirac sodium salt. Zomepirac sodium salt (McN-2783-21-98) is a potent prostaglandin biosynthesis inhibitor. Zomepirac sodium salt is a non-steroidal anti-inflammatory drug (NSAID). Zomepirac sodium salt can cause immune-mediated liver injury[1][2]. |
| Name | Zomepirac-d4 sodium salt |
|---|
| Description | Zomepirac-d4 sodium salt is the deuterium labeled Zomepirac sodium salt. Zomepirac sodium salt (McN-2783-21-98) is a potent prostaglandin biosynthesis inhibitor. Zomepirac sodium salt is a non-steroidal anti-inflammatory drug (NSAID). Zomepirac sodium salt can cause immune-mediated liver injury[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C15H10D4ClNNaO3 |
|---|---|
| Molecular Weight | 317.74 |
| InChIKey | SEEXPXUCHVGZGU-HGSONKNXSA-M |
| SMILES | Cc1cc(CC(=O)[O-])n(C)c1C(=O)c1ccc(Cl)cc1.[Na+] |