4-nitro-phenylalanine methyl ester structure
|
Common Name | 4-nitro-phenylalanine methyl ester | ||
|---|---|---|---|---|
| CAS Number | 85317-52-8 | Molecular Weight | 224.21300 | |
| Density | 1.283g/cm3 | Boiling Point | 360ºC at 760 mmHg | |
| Molecular Formula | C10H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.5ºC | |
| Name | methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 360ºC at 760 mmHg |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.21300 |
| Flash Point | 171.5ºC |
| Exact Mass | 224.08000 |
| PSA | 98.14000 |
| LogP | 1.86110 |
| Index of Refraction | 1.564 |
| InChIKey | FUFUQQWIXMPZFU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(N)Cc1ccc([N+](=O)[O-])cc1 |
|
~99%
4-nitro-phenyla... CAS#:85317-52-8 |
| Literature: National Chiao Tung University Patent: US2011/65905 A1, 2011 ; Location in patent: Page/Page column 5 ; |
|
~90%
4-nitro-phenyla... CAS#:85317-52-8 |
| Literature: The Regents of the University of California Patent: US4622420 A1, 1986 ; |
|
~%
4-nitro-phenyla... CAS#:85317-52-8 |
| Literature: Morandeau, Laurence; Remaud-Le Saec, Patricia; Ouadi, Ali; Bultel-Riviere, Karine; Mougin-Degraef, Marie; De France-Robert, Agnes; Faivre-Chauvet, Alain; Gestin, Jean-Francois Journal of Labelled Compounds and Radiopharmaceuticals, 2006 , vol. 49, # 2 p. 109 - 123 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| H-Phe(4-NO2)-OMeHCl |
| p-nitro-phenylalanine methyl ester |
| methyl 2-amino-3-(4-nitrophenyl)propionate |
| 4-nitro-phenylalanine methyl ester |
| 4-Nitro-phenylalanin-methylester |
| methyl 2-amino-3-(4-nitrophenyl)propanoate |
| (S)-Methyl 2-amino-3-(4-nitrophenyl)propanoate |