2-(4-Chloro-3-nitrobenzoyl)benzoic acid structure
|
Common Name | 2-(4-Chloro-3-nitrobenzoyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 85-54-1 | Molecular Weight | 305.67000 | |
| Density | 1.499 g/cm3 | Boiling Point | 548.4ºC | |
| Molecular Formula | C14H8ClNO5 | Melting Point | 198-201 °C(lit.) | |
| MSDS | USA | Flash Point | 285.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(4-Chloro-3-nitrobenzoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.499 g/cm3 |
|---|---|
| Boiling Point | 548.4ºC |
| Melting Point | 198-201 °C(lit.) |
| Molecular Formula | C14H8ClNO5 |
| Molecular Weight | 305.67000 |
| Flash Point | 285.4ºC |
| Exact Mass | 305.00900 |
| PSA | 100.19000 |
| LogP | 3.70060 |
| InChIKey | RITAQDHCJBLSSL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918300090 |
|
~95%
2-(4-Chloro-3-n... CAS#:85-54-1 |
| Literature: ANGION BIOMEDICA CORP. Patent: WO2006/36981 A2, 2006 ; Location in patent: Page/Page column 83-84 ; |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Catalytic Liquid-Phase Reduction of Aromatic Nitro Compounds Containing Highly Reactive Functional Groups. Zhandarev VV, et al.
Russ. J. Org. Chem. 37(5) , 673-6, (2001)
|
|
|
475. Chemistry of indanthrone. Part VI. Alkylsulphonyl-indanthrones. Bradley W and Nursten HE.
J. Chem. Soc. , 2177-85, (1951)
|
| 3'-Nitro-4'-chlorobenzoylbenzoic acid |
| MFCD00007082 |
| EINECS 201-613-8 |