Ethyl 2-(4-chloro-3-nitrobenzoyl)benzoate
Modify Date: 2025-08-25 22:46:33
Ethyl 2-(4-chloro-3-nitrobenzoyl)benzoate structure
|
Common Name | Ethyl 2-(4-chloro-3-nitrobenzoyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 140861-42-3 | Molecular Weight | 333.72300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 2-(4-chloro-3-nitrobenzoyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12ClNO5 |
|---|---|
| Molecular Weight | 333.72300 |
| Exact Mass | 333.04000 |
| PSA | 89.19000 |
| LogP | 4.17910 |
| InChIKey | UHIHLTDQQZLRIJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccccc1C(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzoic acid,2-(4-chloro-3-nitrobenzoyl)-,ethyl ester |