1-(3,4-Dichlorophenyl)cyclobutanecarboxylic acid
Modify Date: 2025-11-26 09:27:33
1-(3,4-Dichlorophenyl)cyclobutanecarboxylic acid structure
|
Common Name | 1-(3,4-Dichlorophenyl)cyclobutanecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 84485-58-5 | Molecular Weight | 245.102 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 388.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.8±27.9 °C | |
| Name | 1-(3,4-dichlorophenyl)cyclobutane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 388.5±42.0 °C at 760 mmHg |
| Molecular Formula | C11H10Cl2O2 |
| Molecular Weight | 245.102 |
| Flash Point | 188.8±27.9 °C |
| Exact Mass | 244.005783 |
| PSA | 37.30000 |
| LogP | 3.18 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | LKLDQXZDZVETAB-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(c2ccc(Cl)c(Cl)c2)CCC1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2916399090 |
|
~62%
1-(3,4-Dichloro... CAS#:84485-58-5 |
| Literature: Akopyan; Martirosyan; Mndzhoyan; Ter-Zakharyan; Kazaryan; Aleksanyan Pharmaceutical Chemistry Journal, 2001 , vol. 35, # 8 p. 421 - 423 |
|
~%
1-(3,4-Dichloro... CAS#:84485-58-5 |
| Literature: Akopyan; Martirosyan; Mndzhoyan; Ter-Zakharyan; Kazaryan; Aleksanyan Pharmaceutical Chemistry Journal, 2001 , vol. 35, # 8 p. 421 - 423 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Cyclobutanecarboxylic acid, 1-(3,4-dichlorophenyl)- |
| 1-(3,4-Dichlorophenyl)cyclobutanecarboxylic acid |