3,7-Dichloroquinoline-8-carboxylic acid structure
|
Common Name | 3,7-Dichloroquinoline-8-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 84087-01-4 | Molecular Weight | 242.058 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 405.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H5Cl2NO2 | Melting Point | 274ºC | |
| MSDS | Chinese USA | Flash Point | 199.0±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 3,7-Dichloroquinoline-8-carboxylic acidQuinclorac, an herbicide widely applied in agriculture, induces oxidative stress due to free radical generation and changes in the antioxidant defense system[1]. |
| Name | quinclorac |
|---|---|
| Synonym | More Synonyms |
| Description | Quinclorac, an herbicide widely applied in agriculture, induces oxidative stress due to free radical generation and changes in the antioxidant defense system[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 405.4±40.0 °C at 760 mmHg |
| Melting Point | 274ºC |
| Molecular Formula | C10H5Cl2NO2 |
| Molecular Weight | 242.058 |
| Flash Point | 199.0±27.3 °C |
| Exact Mass | 240.969727 |
| PSA | 50.19000 |
| LogP | 2.11 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.695 |
| InChIKey | FFSSWMQPCJRCRV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(Cl)ccc2cc(Cl)cnc12 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R43 |
| Safety Phrases | 2-24-37 |
| RIDADR | 1993 |
| RTECS | VB1984000 |
| Packaging Group | III |
| Hazard Class | 3.2 |
| HS Code | 2933499014 |
|
~93%
3,7-Dichloroqui... CAS#:84087-01-4 |
| Literature: BASF Aktiengesellschaft Patent: US4497651 A1, 1985 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499014 |
|---|---|
| Summary | 2933499014 3,7-dichloroquinoline-8-carboxylic acid。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:20.0% |
|
The diageotropica mutation and synthetic auxins differentially affect the expression of auxin-regulated genes in tomato.
Plant Physiol. 109(1) , 293-7, (1995) The effect of a tomato (Lycopersicon esculentum) mutation, diageotropica (dgt), on the accumulation of mRNA corresponding to tomato homologs of three auxin-regulated genes, LeAux, LeSAUR, and Lepar, w... |
|
|
Phylogenetic and degradation characterization of Burkholderia cepacia WZ1 degrading herbicide quinclorac.
J. Environ. Sci. Health B 38(6) , 771-82, (2003) Strain WZI capable of degrading quinclorac was isolated from a pesticide manufactory soil and considered to be Burkholderia cepacia, belonged to bacteria, Proteobacteria, beta-Proteobacteria, based on... |
|
|
Influences of quinclorac on culturable microorganisms and soil respiration in flooded paddy soil.
Biomed. Environ. Sci. 16(4) , 314-22, (2003) To investigate the potential effects of herbicide quinclorac (3,7-dichloro-8-quinoline-carboxylic) on the culturable microorganisms in flooded paddy soil.Total soil aerobic bacteria, actinomycetes and... |
| FAS-NOX |
| 3,7-dichloroquinoline-8-carboxylic acid |
| 3,7-dichloro-8-quinoline carboxylic acid |
| BAS 514 |
| Facet 75 DF |
| Parmount |
| FACET |
| Quinclorac |
| T66 BNJ DG IG JVQ |
| QUEEN |
| MFCD00072495 |
| 3,7-dichloro-quinoline-8-carboxylic acid |
| BAS-514-H |
| 8-Quinolinecarboxylic acid, 3,7-dichloro- |
| Drive |
| Facet LA |
| EINECS 402-780-1 |
| 3,7-Dichloro-8-quinolinecarboxylic acid |