10-(3-Sulfopropyl)acridinium betaine structure
|
Common Name | 10-(3-Sulfopropyl)acridinium betaine | ||
|---|---|---|---|---|
| CAS Number | 83907-41-9 | Molecular Weight | 301.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO3S | Melting Point | 280-290ºC (dec.) | |
| MSDS | N/A | Flash Point | N/A | |
Use of 10-(3-Sulfopropyl)acridinium betaine10-(3-Sulfopropyl)acridinium Betaine is a fluorescent dye with high durability (>3 months)[1]. |
| Name | 3-acridin-10-ium-10-ylpropane-1-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | 10-(3-Sulfopropyl)acridinium Betaine is a fluorescent dye with high durability (>3 months)[1]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 280-290ºC (dec.) |
|---|---|
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.36000 |
| Exact Mass | 301.07700 |
| PSA | 69.46000 |
| LogP | 3.29660 |
| InChIKey | SMKBSSHVLHIPLU-UHFFFAOYSA-N |
| SMILES | O=S(=O)([O-])CCC[n+]1c2ccccc2cc2ccccc21 |
| Safety Phrases | 22-24/25 |
|---|---|
| WGK Germany | 3 |
| HS Code | 2933990090 |
|
~83%
10-(3-Sulfoprop... CAS#:83907-41-9 |
| Literature: Adamczyk, Maciej; Rege, Sushil Tetrahedron Letters, 1998 , vol. 39, # 52 p. 9587 - 9588 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-acridin-10-ylpropanesulfonic acid |
| 10-(3-Sulfopropyl)acridinium betaine |
| 3-(10-Acridinio)propanesulfonate |
| N-(3-Sulfopropyl)acridinium |
| 10-(3-sulfonatopropyl)acridinium |
| N-(3-Sulfopropyl)acridinium inner salt |
| N-sulphonatopropyl acridine |