SPQ structure
|
Common Name | SPQ | ||
|---|---|---|---|---|
| CAS Number | 83907-40-8 | Molecular Weight | 281.32800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO4S | Melting Point | 299ºC dec. | |
| MSDS | N/A | Flash Point | N/A | |
Use of SPQSPQ is being used to examine and measure membrane chloride transport mechanisms. |
| Name | spq |
|---|---|
| Synonym | More Synonyms |
| Description | SPQ is being used to examine and measure membrane chloride transport mechanisms. |
|---|---|
| Related Catalog |
| Melting Point | 299ºC dec. |
|---|---|
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.32800 |
| Exact Mass | 281.07200 |
| PSA | 78.69000 |
| LogP | 2.15200 |
| InChIKey | ZVDGOJFPFMINBM-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(ccc[n+]2CCCS(=O)(=O)[O-])c1 |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| HS Code | 2933499090 |
|
~93%
SPQ CAS#:83907-40-8 |
| Literature: Adamczyk, Maciej; Rege, Sushil Tetrahedron Letters, 1998 , vol. 39, # 52 p. 9587 - 9588 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-sulphonatopropyl 6-methoxyquinoline |