ethyl N-(ethoxycarbonyl)-N-(3-ethoxy-3-oxopropyl)-beta-alaninate structure
|
Common Name | ethyl N-(ethoxycarbonyl)-N-(3-ethoxy-3-oxopropyl)-beta-alaninate | ||
|---|---|---|---|---|
| CAS Number | 83783-66-8 | Molecular Weight | 289.32500 | |
| Density | 1.109g/cm3 | Boiling Point | 370.8ºC at 760 mmHg | |
| Molecular Formula | C13H23NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178ºC | |
| Name | ethyl 3-[ethoxycarbonyl-(3-ethoxy-3-oxopropyl)amino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.109g/cm3 |
|---|---|
| Boiling Point | 370.8ºC at 760 mmHg |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.32500 |
| Flash Point | 178ºC |
| Exact Mass | 289.15300 |
| PSA | 82.14000 |
| LogP | 1.35130 |
| Index of Refraction | 1.459 |
| InChIKey | DOSKWSBUTUXZAA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCN(CCC(=O)OCC)C(=O)OCC |
| HS Code | 2922509090 |
|---|
|
~87%
ethyl N-(ethoxy... CAS#:83783-66-8 |
| Literature: Yao, Ri-Sheng; Jiang, Lai-En; Wu, Sheng-Hua; Deng, Sheng-Song; Yang, Yang Asian Journal of Chemistry, 2011 , vol. 23, # 9 p. 3792 - 3794 |
|
~%
ethyl N-(ethoxy... CAS#:83783-66-8 |
| Literature: H. Lundbeck A/S Patent: US4608378 A1, 1986 ; |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 280-800-6 |