6-(4-methylsulfanylphenyl)pyridine-2-carbaldehyde structure
|
Common Name | 6-(4-methylsulfanylphenyl)pyridine-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 834884-85-4 | Molecular Weight | 229.29800 | |
| Density | 1.22g/cm3 | Boiling Point | 386.6ºC at 760 mmHg | |
| Molecular Formula | C13H11NOS | Melting Point | 94-98ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 187.6ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 6-(4-methylsulfanylphenyl)pyridine-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 386.6ºC at 760 mmHg |
| Melting Point | 94-98ºC(lit.) |
| Molecular Formula | C13H11NOS |
| Molecular Weight | 229.29800 |
| Flash Point | 187.6ºC |
| Exact Mass | 229.05600 |
| PSA | 55.26000 |
| LogP | 3.28300 |
| Index of Refraction | 1.635 |
| InChIKey | PBHUZBQNKVILJP-UHFFFAOYSA-N |
| SMILES | CSc1ccc(-c2cccc(C=O)n2)cc1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 22-37/38-41 |
| Safety Phrases | 26-39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-[4-(Methylthio)phenyl]-2-pyridinecarboxaldehyde |
| 2-PYRIDINECARBOXALDEHYDE,6-[4-(METHYLTHIO)PHENYL] |
| BM519 |