6-(4-(METHYLSULFONYL)PHENYL)-2-PYRIDINE&
Modify Date: 2025-08-26 10:42:10
6-(4-(METHYLSULFONYL)PHENYL)-2-PYRIDINE& structure
|
Common Name | 6-(4-(METHYLSULFONYL)PHENYL)-2-PYRIDINE& | ||
|---|---|---|---|---|
| CAS Number | 834884-84-3 | Molecular Weight | 261.29600 | |
| Density | 1.297g/cm3 | Boiling Point | 477.3ºC at 760 mmHg | |
| Molecular Formula | C13H11NO3S | Melting Point | 166-170ºC | |
| MSDS | Chinese USA | Flash Point | 242.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 6-(4-methylsulfonylphenyl)pyridine-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.297g/cm3 |
|---|---|
| Boiling Point | 477.3ºC at 760 mmHg |
| Melting Point | 166-170ºC |
| Molecular Formula | C13H11NO3S |
| Molecular Weight | 261.29600 |
| Flash Point | 242.5ºC |
| Exact Mass | 261.04600 |
| PSA | 72.48000 |
| LogP | 3.04540 |
| Index of Refraction | 1.586 |
| InChIKey | QXKMSDYWZMIYDE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(-c2cccc(C=O)n2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
|
~94%
6-(4-(METHYLSUL... CAS#:834884-84-3 |
| Literature: RVX Therapeutics Inc.; Fairfax, David John; Martin, Gregory Scott; Quinn, John Frederick; Duffy, Bryan Cordell; Wagner, Gregory Steven; Young, Peter Ronald Patent: US2014/140956 A1, 2014 ; Location in patent: Paragraph 0673; 0674 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-(4-(methylsulfonyl)phenyl)picolinaldehyde |
| 6-[4-(Methylsulfonyl)phenyl]-2-pyridinecarboxaldehyde |
| 6-[4-Methanesulfonyl)phenyl]pyridine-2-carbaldehyde |
| 2-PYRIDINECARBOXALDEHYDE,6-[4-(METHYLSULFONYL)PHENYL] |