7-pyridin-4-yl-1H-indole structure
|
Common Name | 7-pyridin-4-yl-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 827025-07-0 | Molecular Weight | 194.23200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-pyridin-4-yl-1H-indole |
|---|
| Molecular Formula | C13H10N2 |
|---|---|
| Molecular Weight | 194.23200 |
| Exact Mass | 194.08400 |
| PSA | 28.68000 |
| LogP | 3.22990 |
| InChIKey | GTJZMWIQOZZSCJ-UHFFFAOYSA-N |
| SMILES | c1cc(-c2ccncc2)c2[nH]ccc2c1 |
|
~25%
7-pyridin-4-yl-... CAS#:827025-07-0 |
| Literature: Mudadu, Maria Salvatora; Singh, Ajay; Thummel, Randolph P. Journal of Organic Chemistry, 2006 , vol. 71, # 20 p. 7611 - 7617 |
|
~%
7-pyridin-4-yl-... CAS#:827025-07-0 |
| Literature: Mudadu, Maria Salvatora; Singh, Ajay; Thummel, Randolph P. Journal of Organic Chemistry, 2006 , vol. 71, # 20 p. 7611 - 7617 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |