1-naphthylamine-8-sulfonic acid structure
|
Common Name | 1-naphthylamine-8-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 82-75-7 | Molecular Weight | 223.248 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO3S | Melting Point | >350°C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-Amino-1-Naphthalenesulfonic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Melting Point | >350°C |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.248 |
| Exact Mass | 223.030319 |
| PSA | 88.77000 |
| LogP | 0.42 |
| Index of Refraction | 1.713 |
| InChIKey | CYJJLCDCWVZEDZ-UHFFFAOYSA-N |
| SMILES | Nc1cccc2cccc(S(=O)(=O)O)c12 |
| Hazard Codes | C:Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S27-S36-S45 |
| RIDADR | UN 3261 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2921450090 |
|
~%
1-naphthylamine... CAS#:82-75-7 |
| Literature: DE40571 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 1, p. 393 |
|
~%
1-naphthylamine... CAS#:82-75-7 |
| Literature: Chemische Berichte, , vol. 27, p. 2141 |
|
~%
1-naphthylamine... CAS#:82-75-7 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 275, p. 252 |
|
~%
1-naphthylamine... CAS#:82-75-7 |
| Literature: Helvetica Chimica Acta, , vol. 3, p. 309 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2921450090 |
|---|---|
| Summary | 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1-naphthylamine-8-sulfonic acid |
| EINECS 201-437-1 |
| 8-Amino-1-naphthalenesulfonic acid |
| 1-Naphthalenesulfonic acid, 8-amino- |
| 8-Aminonaphthalene-1-sulfonic acid |
| Peri acid |
| MFCD00035730 |