15-Deoxoeucosterol structure
|
Common Name | 15-Deoxoeucosterol | ||
|---|---|---|---|---|
| CAS Number | 81241-53-4 | Molecular Weight | 458.67 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 575.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C29H46O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.8±23.6 °C | |
Use of 15-Deoxoeucosterol15-Deoxoeucosterol is a compound isolated from the bulbs of Scilla scilloides[1]. |
| Name | 1-((3S,3'R,4S,5R,5'S,10S,13S,14S,17S)-3-hydroxy-4-(hydroxymethyl)-3',4,10,13,14-pentamethyl-1,2,3,4,4',5,5',6,7,10,11,12,13,14,15,16-hexadecahydro-3'H-spiro[cyclopenta[a]phenanthrene-17,2'-furan]-5'-yl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | 15-Deoxoeucosterol is a compound isolated from the bulbs of Scilla scilloides[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 575.4±50.0 °C at 760 mmHg |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.67 |
| Flash Point | 181.8±23.6 °C |
| Exact Mass | 458.339600 |
| PSA | 66.76000 |
| LogP | 5.33 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | WKRCCXBCFBIWPN-KNRSYIFPSA-N |
| SMILES | CCC(=O)C1CC(C)C2(CCC3(C)C4=C(CCC32C)C2(C)CCC(O)C(C)(CO)C2CC4)O1 |
| Hazard Codes | Xi |
|---|
| 1-[(3S,3'R,4S,5R,5'S,10S,13S,14S,17S)-3-Hydroxy-4-(hydroxymethyl)-3',4,10,13,14-pentamethyl-1,2,3,4,4',5,5',6,7,10,11,12,13,14,15,16-hexadecahydro-3'H-spiro[cyclopenta[a]phenanthrene-17,2'-furan]-5'-yl]-1-propanone |