Benzenesulfonanilide, 2-amino-N-ethyl- structure
|
Common Name | Benzenesulfonanilide, 2-amino-N-ethyl- | ||
|---|---|---|---|---|
| CAS Number | 81-10-7 | Molecular Weight | 276.354 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 445.4±47.0 °C at 760 mmHg | |
| Molecular Formula | C14H16N2O2S | Melting Point | 56-60 °C(lit.) | |
| MSDS | N/A | Flash Point | 223.1±29.3 °C | |
| Name | 2-Amino-N-ethylbenzenesulfonanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 445.4±47.0 °C at 760 mmHg |
| Melting Point | 56-60 °C(lit.) |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.354 |
| Flash Point | 223.1±29.3 °C |
| Exact Mass | 276.093262 |
| PSA | 71.78000 |
| LogP | 2.10 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | OXZNTECZWGFYMM-UHFFFAOYSA-N |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccccc1N |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2935009090 |
|
~99%
Benzenesulfonan... CAS#:81-10-7 |
| Literature: Bamfield, Peter; Greenwood, David; Lotey, Harvinder; Stirling, Charles J. M. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1988 , p. 691 - 696 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| EINECS 201-324-7 |
| 2-Amino-N-ethyl-N-phenylbenzenesulfonamide |
| MFCD00025186 |
| 2-Amino-N-ethyl-N-phenylbenzene sulfonamide |
| Benzenesulfonanilide, 2-amino-N-ethyl- |
| N-Ethyl-N-phenyl-o-aminobenzenesulfonamide |
| Benzenesulfonamide, 2-amino-N-ethyl-N-phenyl- |
| Benzenesulfonanilide, 2-amino-n-ethyl-, |