Sec-O-Glucosylhamaudol structure
|
Common Name | Sec-O-Glucosylhamaudol | ||
|---|---|---|---|---|
| CAS Number | 80681-44-3 | Molecular Weight | 438.425 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 677.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C21H26O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.2±25.0 °C | |
Use of Sec-O-GlucosylhamaudolSec-O-Glucosylhamaudol is a natural compound extracted from Peucedanum japonicum Thunb, decreases levels of μ-opioid receptor, with analgesic effect[1]. |
| Name | (3S)-5-hydroxy-2,2,8-trimethyl-3-[(1R,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxy-3,4-dihydropyrano[3,2-g]chromen-6-one |
|---|---|
| Synonym | More Synonyms |
| Description | Sec-O-Glucosylhamaudol is a natural compound extracted from Peucedanum japonicum Thunb, decreases levels of μ-opioid receptor, with analgesic effect[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 677.5±55.0 °C at 760 mmHg |
| Molecular Formula | C21H26O10 |
| Molecular Weight | 438.425 |
| Flash Point | 237.2±25.0 °C |
| Exact Mass | 438.152588 |
| PSA | 159.05000 |
| LogP | 0.39 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | QVUPQEXKTXSMKX-JJDILSOYSA-N |
| SMILES | Cc1cc(=O)c2c(O)c3c(cc2o1)OC(C)(C)C(OC1OC(CO)C(O)C(O)C1O)C3 |
| Storage condition | 2-8C |
| (3S)-5-Hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydro-2H,6H-pyrano[3,2-g]chromen-3-yl β-D-glucopyranoside |
| sec-O-glucosyl hamaudol |
| 2H,6H-Benzo[1,2-b:5,4-b']dipyran-6-one, 3-(β-D-glucopyranosyloxy)-3,4-dihydro-5-hydroxy-2,2,8-trimethyl-, (3S)- |
| sec-O-Glucosylhamaudol |