1H-Isoindole-1,3(2H)-dione,2-(2,4-dichlorophenyl)- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,2-(2,4-dichlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 80460-33-9 | Molecular Weight | 292.11700 | |
| Density | 1.532g/cm3 | Boiling Point | 456.8ºC at 760 mmHg | |
| Molecular Formula | C14H7Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230ºC | |
| Name | 2,4-dichloro-N-methyl-aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.532g/cm3 |
|---|---|
| Boiling Point | 456.8ºC at 760 mmHg |
| Molecular Formula | C14H7Cl2NO2 |
| Molecular Weight | 292.11700 |
| Flash Point | 230ºC |
| Exact Mass | 290.98500 |
| PSA | 37.38000 |
| LogP | 3.85900 |
| Index of Refraction | 1.677 |
| InChIKey | YGVRZPDPDDFDLR-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc(Cl)cc1Cl |
|
~96%
1H-Isoindole-1,... CAS#:80460-33-9 |
| Literature: Rauf, Muhammad Khawar; Mushtaq, Rabia; Badshah, Amin; Kingsford-Adaboh, Robert; Harrison, Jerry Joe Ebow Kingsley; Ishida, Hiroyuki Journal of Chemical Crystallography, 2013 , vol. 43, # 3 p. 144 - 150 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N1-METHYL-2,4-DICHLOROANILINE |
| 2,4-Dichlor-N-methyl-anilin |
| N-methyl-2,4-dichloro-aniline |
| 2.4-Dichloro-N-methylanilin |