1H-Isoindole-1,3(2H)-dione,2-(2,4,6-cycloheptatrien-1-yl)-
Modify Date: 2025-09-09 10:33:38
1H-Isoindole-1,3(2H)-dione,2-(2,4,6-cycloheptatrien-1-yl)- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,2-(2,4,6-cycloheptatrien-1-yl)- | ||
|---|---|---|---|---|
| CAS Number | 92497-80-8 | Molecular Weight | 237.25300 | |
| Density | 1.315g/cm3 | Boiling Point | 393.7ºC at 760mmHg | |
| Molecular Formula | C15H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.2ºC | |
| Name | 2-cyclohepta-2,4,6-trien-1-ylisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.315g/cm3 |
|---|---|
| Boiling Point | 393.7ºC at 760mmHg |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.25300 |
| Flash Point | 180.2ºC |
| Exact Mass | 237.07900 |
| PSA | 37.38000 |
| LogP | 2.27130 |
| Index of Refraction | 1.662 |
| InChIKey | FFRBLLZZLAGORU-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1C1C=CC=CC=C1 |
|
~92%
1H-Isoindole-1,... CAS#:92497-80-8 |
| Literature: Dushenko; Mikhailova; Mikhailov; Minyaev; Minkin Doklady Chemistry, 2010 , vol. 430, # 1 p. 11 - 17 |
|
~88%
1H-Isoindole-1,... CAS#:92497-80-8 |
| Literature: Dushenko; Mikhailov; Mikhailova; Minkin Russian Journal of Organic Chemistry, 2002 , vol. 38, # 8 p. 1214 - 1215 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 7-phthalimido-1,3,5-cycloheptatriene |
| N-(1,3,5-cycloheptatrien-7-yl)phthalimide |
| N-(cyclohepta-1,3,5-trien-7-yl)phthalimide |
| N-Tropyl-phthalimid |
| N-cyclohepta-2,4,6-trienyl-phthalimide |
| 2-(cyclohepta-2,4,6-trien-1-yl)-1h-isoindole-1,3(2h)-dione |