5-(benzenesulfonyl)-1-methyl-4-nitro-imidazole structure
|
Common Name | 5-(benzenesulfonyl)-1-methyl-4-nitro-imidazole | ||
|---|---|---|---|---|
| CAS Number | 80348-54-5 | Molecular Weight | 267.26100 | |
| Density | 1.51g/cm3 | Boiling Point | 562.5ºC at 760 mmHg | |
| Molecular Formula | C10H9N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294ºC | |
| Name | 5-(benzenesulfonyl)-1-methyl-4-nitroimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 562.5ºC at 760 mmHg |
| Molecular Formula | C10H9N3O4S |
| Molecular Weight | 267.26100 |
| Flash Point | 294ºC |
| Exact Mass | 267.03100 |
| PSA | 106.16000 |
| LogP | 2.76510 |
| Index of Refraction | 1.665 |
| InChIKey | RROUABPKRUXIBP-UHFFFAOYSA-N |
| SMILES | Cn1cnc([N+](=O)[O-])c1S(=O)(=O)c1ccccc1 |
|
~75%
5-(benzenesulfo... CAS#:80348-54-5 |
| Literature: Kulkarni, Surendra; Grimmett, M. Ross Australian Journal of Chemistry, 1987 , vol. 40, # 8 p. 1415 - 1425 |
|
~%
5-(benzenesulfo... CAS#:80348-54-5 |
| Literature: Kulkarni, Surendra; Grimmett, M. Ross Australian Journal of Chemistry, 1987 , vol. 40, # 8 p. 1415 - 1425 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-benzenesulfonyl-1-methyl-4-nitro-1H-imidazole |
| 1-methyl-4-nitro-5-phenylsulfonylimidazole |
| 5-Benzolsulfonyl-1-methyl-4-nitro-1H-imidazol |