1H-Imidazole,1-methyl-4-nitro-5-(phenylthio)-
Modify Date: 2025-10-19 17:33:17
1H-Imidazole,1-methyl-4-nitro-5-(phenylthio)- structure
|
Common Name | 1H-Imidazole,1-methyl-4-nitro-5-(phenylthio)- | ||
|---|---|---|---|---|
| CAS Number | 80812-44-8 | Molecular Weight | 235.26200 | |
| Density | 1.37g/cm3 | Boiling Point | 427.7ºC at 760mmHg | |
| Molecular Formula | C10H9N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.5ºC | |
| Name | 1-methyl-4-nitro-5-phenylsulfanylimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 427.7ºC at 760mmHg |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.26200 |
| Flash Point | 212.5ºC |
| Exact Mass | 235.04200 |
| PSA | 88.94000 |
| LogP | 3.00270 |
| Index of Refraction | 1.668 |
| InChIKey | JSTDAVYXINFTFX-UHFFFAOYSA-N |
| SMILES | Cn1cnc([N+](=O)[O-])c1Sc1ccccc1 |
|
~77%
1H-Imidazole,1-... CAS#:80812-44-8 |
| Literature: Kulkarni, Surendra; Grimmett, M. Ross Australian Journal of Chemistry, 1987 , vol. 40, # 8 p. 1415 - 1425 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:80348-54-5| 1-Methyl-4-nitro-5-phenylmercapto-1H-imidazol |
| 1-methyl-4-nitro-5-phenylsulfanyl-1H-imidazole |
| 1-methyl-4-nitro-5-phenylthioimidazole |
| HMS2410M21 |