tribulosin structure
|
Common Name | tribulosin | ||
|---|---|---|---|---|
| CAS Number | 79974-46-2 | Molecular Weight | 1151.29000 | |
| Density | 1.50 | Boiling Point | N/A | |
| Molecular Formula | C55H90O25 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | tribulosin |
|---|
| Density | 1.50 |
|---|---|
| Molecular Formula | C55H90O25 |
| Molecular Weight | 1151.29000 |
| Exact Mass | 1150.58000 |
| PSA | 373.75000 |
| InChIKey | YYCFEJVBMMGRLX-BTLNAVNBSA-N |
| SMILES | CC1CCC2(OC1)OC1CC3C4CCC5CC(OC6OC(CO)C(OC7OC(CO)C(O)C(OC8OCC(O)C(O)C8O)C7OC7OCC(O)C(O)C7O)C(O)C6OC6OC(C)C(O)C(O)C6O)CCC5(C)C4CCC3(C)C1C2C |
| RIDADR | NONH for all modes of transport |
|---|
| Precursor 0 | |
|---|---|
| DownStream 4 | |
|
Tribulosin and beta-sitosterol-D-glucoside, the anthelmintic principles of Tribulus terrestris.
Phytomedicine 9 , 753-756, (2002) Successive extracts of Tribulus terrestris prepared using petroleum ether, chloroform, 50% methanol and water were tested for anthelmintic activity in-vitro using the nematode Caenorhabditis elegans. ... |