cFMS-IN-2 structure
|
Common Name | cFMS-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 791587-67-2 | Molecular Weight | 339.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H21N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of cFMS-IN-2cFMS-IN-2 is a FMS kinase inhibitor with an IC50 of 0.024 μM. |
| Name | cFMS-IN-2 |
|---|
| Description | cFMS-IN-2 is a FMS kinase inhibitor with an IC50 of 0.024 μM. |
|---|---|
| Related Catalog | |
| Target |
FMS[1] |
| References |
| Molecular Formula | C19H21N3O3 |
|---|---|
| Molecular Weight | 339.39 |
| InChIKey | NNPCFFIJVKYGHR-UHFFFAOYSA-N |
| SMILES | CC1CCN(c2ccc(CO)cc2NC(=O)c2ccc(C#N)o2)CC1 |