[(4-Chlorophenyl)ethynyl](trimethyl)silane structure
|
Common Name | [(4-Chlorophenyl)ethynyl](trimethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 78704-49-1 | Molecular Weight | 208.759 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 231.2±32.0 °C at 760 mmHg | |
| Molecular Formula | C11H13ClSi | Melting Point | 47-51ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 95.4±19.9 °C | |
| Name | 2-(4-chlorophenyl)ethynyl-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 231.2±32.0 °C at 760 mmHg |
| Melting Point | 47-51ºC(lit.) |
| Molecular Formula | C11H13ClSi |
| Molecular Weight | 208.759 |
| Flash Point | 95.4±19.9 °C |
| Exact Mass | 208.047501 |
| LogP | 5.05 |
| Appearance of Characters | Solid | White to pale brown |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | HVIHXUCWKNRJTC-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#Cc1ccc(Cl)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Benzene, 1-chloro-4-[2-(trimethylsilyl)ethynyl]- |
| chloro-4-trimethylsilylethynylbenzene |
| 1-[(trimethylsilyl)ethynyl]-4-chlorobenzene |
| (2-(4-chlorophenyl)ethynyl)trimethylsilane |
| [(4-Chlorophenyl)ethynyl](trimethyl)silane |
| 1-(4-chlorophenyl)-2-trimethylsilylacetylene |
| trimethylsilyl-4-chlorophenylacetylene |
| 2(4-chlorophenyl)-1-trimethylsilylethyne |
| ((4-chlorophenyl)ethynyl)trimethylsilane |
| MFCD03427267 |