nelumol a
Modify Date: 2025-08-22 12:58:41
nelumol a structure
|
Common Name | nelumol a | ||
|---|---|---|---|---|
| CAS Number | 77836-86-3 | Molecular Weight | 346.46 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 500.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H30O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.5±30.1 °C | |
Use of nelumol aNelumol A is a farnesoid X receptor (FXR) agonist[1]. |
| Name | (E)-3-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3,5-dimethoxyphenyl]prop-2-en-1-ol |
|---|---|
| Synonym | More Synonyms |
| Description | Nelumol A is a farnesoid X receptor (FXR) agonist[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 500.5±50.0 °C at 760 mmHg |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.46 |
| Flash Point | 256.5±30.1 °C |
| Exact Mass | 346.214417 |
| PSA | 47.92000 |
| LogP | 5.20 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.540 |
| InChIKey | MWNIFFJAKKQUJF-NRHDHWSESA-N |
| SMILES | COc1cc(C=CCO)cc(OC)c1OCC=C(C)CCC=C(C)C |
| Hazard Codes | Xi |
|---|
| O-Geranylsinapyl alcohol |
| 2-Propen-1-ol, 3-[4-[[(2E)-3,7-dimethyl-2,6-octadien-1-yl]oxy]-3,5-dimethoxyphenyl]-, (2E)- |
| (2E)-3-(4-{[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]oxy}-3,5-dimethoxyphenyl)-2-propen-1-ol |
| (E,E)-3-(4-((3,7-Dimethyl-2,6-octadienyl)oxy)-3,5-dimethoxyphenyl)-2-propen-1-ol |
| Nelumol A |
| 2-Propen-1-ol, 3-(4-((3,7-dimethyl-2,6-octadienyl)oxy)-3,5-dimethoxyphenyl)-, (E,E)- |
| 4-O-geranyl-sinapyl alcohol |
| geranyloxy sinapyl alcohol |