15-Oxo-9-hydroxykaur-16-en-18-oic acid
Modify Date: 2025-08-25 15:41:45
15-Oxo-9-hydroxykaur-16-en-18-oic acid structure
|
Common Name | 15-Oxo-9-hydroxykaur-16-en-18-oic acid | ||
|---|---|---|---|---|
| CAS Number | 77658-39-0 | Molecular Weight | 332.434 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 509.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.3±26.6 °C | |
| Name | (5β,8α,9β,10α,13α)-9-Hydroxy-15-oxokaur-16-en-18-oic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 509.9±50.0 °C at 760 mmHg |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.434 |
| Flash Point | 276.3±26.6 °C |
| Exact Mass | 332.198761 |
| PSA | 74.60000 |
| LogP | 2.46 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | AURKCYFYZBQUIZ-FYGCSPHNSA-N |
| SMILES | C=C1C(=O)C23CCC4C(C)(C(=O)O)CCCC4(C)C2(O)CCC1C3 |
| Hazard Codes | Xi |
|---|
|
~%
15-Oxo-9-hydrox... CAS#:77658-39-0 |
| Literature: Tanaka; Murakami; Saiki; et al. Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 12 p. 3455 - 3463 |
|
~%
15-Oxo-9-hydrox... CAS#:77658-39-0 |
| Literature: Murakami; Iida; Tanaka; et al. Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 3 p. 657 - 662 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:77658-45-8| (5β,8α,9β,10α,13α)-9-Hydroxy-15-oxokaur-16-en-18-oic acid |
| 9-hydroxy-15-oxo-ent-kaur-16-en-19-oic acid |