N-p-Tosylazetidine structure
|
Common Name | N-p-Tosylazetidine | ||
|---|---|---|---|---|
| CAS Number | 7730-45-2 | Molecular Weight | 211.281 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 337.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H13NO2S | Melting Point | 119-122ºC(lit.) | |
| MSDS | USA | Flash Point | 158.0±25.9 °C | |
| Name | 1-(4-methylphenyl)sulfonylazetidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 337.6±35.0 °C at 760 mmHg |
| Melting Point | 119-122ºC(lit.) |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.281 |
| Flash Point | 158.0±25.9 °C |
| Exact Mass | 211.066696 |
| PSA | 45.76000 |
| LogP | 1.68 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | VKCBXONEZGIOSP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Ag(I)-catalyzed regioselective ring-opening of N-tosylaziridine and N-tosylazetidine with S-, O-, and N-nucleophiles and tethered dinucleophiles.
J. Org. Chem. 76(5) , 1475-8, (2011) [Ag(COD)(2)]PF(6) catalyzes the ring-opening of N-tosylaziridines and -azetidines with alcohols, amines, thiols, and related tethered 1,2-ethane dinucleophiles. Initial rate studies and DFT-based eval... |
| MFCD00022359 |
| Azetidine, 1-[(4-methylphenyl)sulfonyl]- |
| p-toluenesulfonylazetidine |
| Azetidine, 1-(p-tolylsulfonyl)- |
| 1-[(4-Methylphenyl)sulfonyl]azetidine |
| Azetidine, 1- (p-tolylsulfonyl)- |
| N-p-Tosylazetidine |
| 1-Tosylazetidine |