(3-Chloro-2-nitrophenyl)methanol structure
|
Common Name | (3-Chloro-2-nitrophenyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 77158-86-2 | Molecular Weight | 187.580 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 319.4±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H6ClNO3 | Melting Point | 65-69ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 147.0±23.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (3-chloro-2-nitrophenyl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 319.4±27.0 °C at 760 mmHg |
| Melting Point | 65-69ºC(lit.) |
| Molecular Formula | C7H6ClNO3 |
| Molecular Weight | 187.580 |
| Flash Point | 147.0±23.7 °C |
| Exact Mass | 187.003616 |
| PSA | 66.05000 |
| LogP | 1.15 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | ZSMDJSXEFYWXPD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(Cl)cccc1CO |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2906299090 |
|
~85%
(3-Chloro-2-nit... CAS#:77158-86-2 |
| Literature: Kimura; Takase; Hayashi; Tanaka; Ohtsuka; Saeki; Kogushi; Yamada; Fujimori; Saitou; Akasaka Journal of Medicinal Chemistry, 1993 , vol. 36, # 11 p. 1630 - 1640 |
|
~%
(3-Chloro-2-nit... CAS#:77158-86-2 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 12, # 9 p. 2397 - 2407 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3-Chloro-2-nitrobenzyl alcohol |
| (3-Chloro-2-nitrophenyl)methanol |
| Benzenemethanol,3-chloro-2-nitro |
| Benzenemethanol, 3-chloro-2-nitro- |
| 3-chloro-2-nitrobenzenemethanol |
| MFCD04038814 |