3-(2-bromoethyl)-1H-quinazoline-2,4-dione structure
|
Common Name | 3-(2-bromoethyl)-1H-quinazoline-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 77093-96-0 | Molecular Weight | 269.09500 | |
| Density | 1.61g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2-bromoethyl)-1H-quinazoline-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.61g/cm3 |
|---|---|
| Molecular Formula | C10H9BrN2O2 |
| Molecular Weight | 269.09500 |
| Exact Mass | 267.98500 |
| PSA | 55.12000 |
| LogP | 1.49700 |
| Index of Refraction | 1.611 |
| InChIKey | HDTBGSPQYIYDES-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2ccccc2c(=O)n1CCBr |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 278-618-7 |