methyl 2-(2-chloroethylcarbamoylamino)benzoate
Modify Date: 2025-08-25 18:47:12
methyl 2-(2-chloroethylcarbamoylamino)benzoate structure
|
Common Name | methyl 2-(2-chloroethylcarbamoylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 77093-92-6 | Molecular Weight | 256.68600 | |
| Density | 1.302g/cm3 | Boiling Point | 372.3ºC at 760 mmHg | |
| Molecular Formula | C11H13ClN2O3 | Melting Point | 142ºC(lit.) | |
| MSDS | N/A | Flash Point | 179ºC | |
| Name | methyl 2-(2-chloroethylcarbamoylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.302g/cm3 |
|---|---|
| Boiling Point | 372.3ºC at 760 mmHg |
| Melting Point | 142ºC(lit.) |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.68600 |
| Flash Point | 179ºC |
| Exact Mass | 256.06100 |
| PSA | 67.43000 |
| LogP | 2.29740 |
| Index of Refraction | 1.577 |
| InChIKey | NUKAPQXOPXRWBX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1NC(=O)NCCCl |
| WGK Germany | 3 |
|---|---|
| HS Code | 2924299090 |
|
~99%
methyl 2-(2-chl... CAS#:77093-92-6 |
| Literature: Papadopoulos, Eleftherios Paul Journal of Heterocyclic Chemistry, 1980 , vol. 17, # 6 p. 1553 - 1558 |
CAS#:5081-87-8![9-(2-chloroethylamino)-8-oxa-10-azabicyclo[4.4.0]deca-1,3,5,9-tetraen-7-one structure](https://image.chemsrc.com/caspic/075/77093-93-7.png)
CAS#:77093-93-7
CAS#:77093-96-0
CAS#:77093-97-1![2H-OXAZOLO[2,3-B]QUINAZOLIN-5(3H)-ONE structure](https://image.chemsrc.com/caspic/400/52727-44-3.png)
CAS#:52727-44-3| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
15N and 13C {14N} NMR investigation of the major nitrogen-containing segment in an aquatic fulvic acid: Evidence for a hydantoin derivative. Fang X, et al.
Magn. Reson. Chem. 49(12) , 775-780, (2011)
|
| MFCD00209597 |