SAP-I structure
|
Common Name | SAP-I | ||
|---|---|---|---|---|
| CAS Number | 76901-59-2 | Molecular Weight | 891.92400 | |
| Density | 1.337g/cm3 | Boiling Point | 1502.321ºC at 760 mmHg | |
| Molecular Formula | C38H57N11O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 862.373ºC | |
Use of SAP-ISperact, a sea urchin egg peptide that regulates sperm motility, also stimulates sperm mitochondrial metabolism. |
| Name | Sperm-activatingpeptide H 2 (Hemicentrotus pulcherrimus egg jelly coat) (9CI) |
|---|---|
| Synonym | More Synonyms |
| Description | Speract, a sea urchin egg peptide that regulates sperm motility, also stimulates sperm mitochondrial metabolism. |
|---|---|
| Related Catalog | |
| In Vitro | Speract is a decapeptide from the outer jelly layer of theStrongylocentrotus purpuratus egg that upon binding to its receptor in the sperm, stimulates sperm motility, respiration and ion fluxes, among other physiological events. Speract increases NADH levels and depolarizes the sea urchin sperm mitochondrion[1]. |
| References |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 1502.321ºC at 760 mmHg |
| Molecular Formula | C38H57N11O14 |
| Molecular Weight | 891.92400 |
| Flash Point | 862.373ºC |
| Exact Mass | 891.40900 |
| PSA | 405.61000 |
| Index of Refraction | 1.565 |
| InChIKey | NURUARRJQOZSIF-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)C(CC(=O)O)NC(=O)C(Cc1ccccc1)NC(=O)CN)C(=O)NC(CC(N)=O)C(=O)NCC(=O)NCC(=O)NCC(=O)NC(C(=O)NCC(=O)O)C(C)C |
| Storage condition | -20°C |
| Hazard Codes | Xn |
|---|
| Speract |