Sodium metabisulfite structure
|
Common Name | Sodium metabisulfite | ||
|---|---|---|---|---|
| CAS Number | 7681-57-4 | Molecular Weight | 190.11 | |
| Density | 1.48 | Boiling Point | N/A | |
| Molecular Formula | Na2O5S2 | Melting Point | 150 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
Use of Sodium metabisulfiteSodium metabisulfite can be used as an excipient, such as antibacterial agent, preservative, antioxidant. Pharmaceutical excipients, or pharmaceutical auxiliaries, refer to other chemical substances used in the pharmaceutical process other than pharmaceutical ingredients. Pharmaceutical excipients generally refer to inactive ingredients in pharmaceutical preparations, which can improve the stability, solubility and processability of pharmaceutical preparations. Pharmaceutical excipients also affect the absorption, distribution, metabolism, and elimination (ADME) processes of co-administered drugs[1]. |
| Name | Sodium metabisulfite |
|---|---|
| Synonym | More Synonyms |
| Description | Sodium metabisulfite can be used as an excipient, such as antibacterial agent, preservative, antioxidant. Pharmaceutical excipients, or pharmaceutical auxiliaries, refer to other chemical substances used in the pharmaceutical process other than pharmaceutical ingredients. Pharmaceutical excipients generally refer to inactive ingredients in pharmaceutical preparations, which can improve the stability, solubility and processability of pharmaceutical preparations. Pharmaceutical excipients also affect the absorption, distribution, metabolism, and elimination (ADME) processes of co-administered drugs[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.48 |
|---|---|
| Melting Point | 150 °C |
| Molecular Formula | Na2O5S2 |
| Molecular Weight | 190.11 |
| Exact Mass | 189.898254 |
| PSA | 124.92000 |
| LogP | 0.27220 |
| InChIKey | HRZFUMHJMZEROT-UHFFFAOYSA-L |
| SMILES | O=S([O-])S(=O)(=O)[O-].[Na+].[Na+] |
| Stability | Stable. Incompatible with strong oxidizing agents, strong acids. Contact with strong acids releases a poisonous gas. May be moisture and air sensitive. |
| Water Solubility | 540 g/L (20 ºC) |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318 |
| Supplemental HS | Contact with acids liberates toxic gas. |
| Precautionary Statements | P280-P301 + P312 + P330-P305 + P351 + P338 + P310 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R22;R31;R41 |
| Safety Phrases | S26-S39-S46 |
| RIDADR | 3260 |
| WGK Germany | 1 |
| RTECS | UX8225000 |
| Packaging Group | III |
| HS Code | 2832100000 |
| HS Code | 2832100000 |
|---|
|
The CRE1 cytokinin pathway is differentially recruited depending on Medicago truncatula root environments and negatively regulates resistance to a pathogen.
PLoS ONE 10(1) , e0116819, (2015) Cytokinins are phytohormones that regulate many developmental and environmental responses. The Medicago truncatula cytokinin receptor MtCRE1 (Cytokinin Response 1) is required for the nitrogen-fixing ... |
|
|
Development of papain containing pellets produced by extrusion-spheronization: an operational stage approach.
Drug Dev. Ind. Pharm. 41(3) , 430-5, (2015) The performance of the standardized extrusion-spheronization technique, operational conditions, formulation parameters and storage of the final product over the bioactivity of papain containing pellet... |
|
|
Quorum Sensing Peptides Selectively Penetrate the Blood-Brain Barrier.
PLoS ONE 10 , e0142071, (2015) Bacteria communicate with each other by the use of signaling molecules, a process called 'quorum sensing'. One group of quorum sensing molecules includes the oligopeptides, which are mainly produced b... |
| Fertisilo |
| MFCD00213787 |
| EINECS 231-673-0 |
| Disodium disulfite |
| Campden Tablets |
| Natrii disulfis |
| Natrium pyrosulfit |
| Sodium disulfite |
| Sodium pyrosulfite |
| Natriumbisulfit |