Croverin structure
|
Common Name | Croverin | ||
|---|---|---|---|---|
| CAS Number | 76475-17-7 | Molecular Weight | 370.396 | |
| Density | 1.33±0.1 g/cm3 (20 ºC 760 Torr) | Boiling Point | 542.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.8±30.1 °C | |
Use of CroverinCroverin is a diterpenoid compound isolated from the aerial parts of Croton laui[1]. |
| Name | Croverin |
|---|---|
| Synonym | More Synonyms |
| Description | Croverin is a diterpenoid compound isolated from the aerial parts of Croton laui[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.33±0.1 g/cm3 (20 ºC 760 Torr) |
|---|---|
| Boiling Point | 542.4±50.0 °C at 760 mmHg |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.396 |
| Flash Point | 281.8±30.1 °C |
| Exact Mass | 370.141632 |
| LogP | 2.81 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | FFWVQGRKTCTNRG-QANQIFJLSA-N |
| SMILES | C=C1CCC23C(=O)OC4OC(c5ccoc5)CC14C2CCC=C3C(=O)OC |
| Hazard Codes | Xn |
|---|
| CROVERIN |