Carbamic acid,diphenyl-, 3,7,11-trimethyl-2,6,10-dodecatrienyl ester, (E,E)- (9CI)
Modify Date: 2025-09-12 14:00:25
Carbamic acid,diphenyl-, 3,7,11-trimethyl-2,6,10-dodecatrienyl ester, (E,E)- (9CI) structure
|
Common Name | Carbamic acid,diphenyl-, 3,7,11-trimethyl-2,6,10-dodecatrienyl ester, (E,E)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 76386-25-9 | Molecular Weight | 417.58300 | |
| Density | 1.03g/cm3 | Boiling Point | 538.5ºC at 760 mmHg | |
| Molecular Formula | C28H35NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.5ºC | |
| Name | [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] N,N-diphenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 538.5ºC at 760 mmHg |
| Molecular Formula | C28H35NO2 |
| Molecular Weight | 417.58300 |
| Flash Point | 279.5ºC |
| Exact Mass | 417.26700 |
| PSA | 29.54000 |
| LogP | 8.38050 |
| Index of Refraction | 1.561 |
| InChIKey | JVKHLVYHRZTVCF-GFUUNDCYSA-N |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCOC(=O)N(c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
Carbamic acid,d... CAS#:76386-25-9 |
| Literature: Cane,D.E.; Iyengar,R.; Shiao,M.S. Journal of the American Chemical Society, 1981 , vol. 103, p. 914 |
|
~%
Carbamic acid,d... CAS#:76386-25-9 |
| Literature: Naves Helvetica Chimica Acta, 1946 , vol. 29, p. 1090 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] N,N-di(phenyl)carbamate |
| Diphenylcarbamidsaeure-trans-trans-farnesylester |
| trans-trans-Farnesyl-N,N-diphenyl-urethan |
| diphenylcarbamic acid-(3.7.11-trimethyl-dodecatrien-(2t.6t.10)-yl ester) |
| Diphenylcarbamidsaeure-(3.7.11-trimethyl-dodecatrien-(2t.6t.10)-ylester) |
| trans,trans-farnesyl diphenylurethane |