Altanserin
Modify Date: 2025-08-25 23:34:23
Altanserin structure
|
Common Name | Altanserin | ||
|---|---|---|---|---|
| CAS Number | 76330-71-7 | Molecular Weight | 411.49 | |
| Density | 1.37 g/cm3 | Boiling Point | 601ºC at 760 mmHg | |
| Molecular Formula | C22H22FN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.3ºC | |
Use of AltanserinAltanserin can synthesize Fluorine-18 Altanserin. Fluorine-18 Altanserin binds to the brain 5HT2 receptors[1]. |
| Name | 3-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Altanserin can synthesize Fluorine-18 Altanserin. Fluorine-18 Altanserin binds to the brain 5HT2 receptors[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Altanserin can synthesize Fluorine-18 Altanserin[1]. |
| References |
| Density | 1.37 g/cm3 |
|---|---|
| Boiling Point | 601ºC at 760 mmHg |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.49 |
| Flash Point | 317.3ºC |
| Exact Mass | 411.14200 |
| PSA | 90.19000 |
| LogP | 3.73100 |
| Index of Refraction | 1.674 |
| InChIKey | SMYALUSCZJXWHG-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)C1CCN(CCn2c(=S)[nH]c3ccccc3c2=O)CC1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36 |
| Safety Phrases | 26 |
| Altanserin |
| Altanserine |
| Altanserina |
| Altanserinum |