Polyphyllin E
Modify Date: 2025-09-01 18:02:08
Polyphyllin E structure
|
Common Name | Polyphyllin E | ||
|---|---|---|---|---|
| CAS Number | 76296-73-6 | Molecular Weight | 1015.185 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C51H82O20 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Polyphyllin EPolyphyllin E is a steroidal saponin that can be isolated from Paris polyphylla[1]. |
| Name | (3β,25R)-Spirost-5-en-3-yl 6-deoxy-α-L-mannopyranosyl-(1->3)-[6-deoxy-α-L-mannopyranosyl-(1->2)-6-deoxy-α-L-mannopyranosyl-(1->4)]-β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Polyphyllin E is a steroidal saponin that can be isolated from Paris polyphylla[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C51H82O20 |
| Molecular Weight | 1015.185 |
| Exact Mass | 1014.539917 |
| LogP | 7.58 |
| Index of Refraction | 1.621 |
| InChIKey | SPDRGXNPOLRBGD-XJADHDRTSA-N |
| SMILES | CC1CCC2(OC1)OC1CC3C4CC=C5CC(OC6OC(CO)C(OC7OC(C)C(O)C(O)C7OC7OC(C)C(O)C(O)C7O)C(OC7OC(C)C(O)C(O)C7O)C6O)CCC5(C)C4CCC3(C)C1C2C |
| Hazard Codes | Xi |
|---|
| (3β,25R)-Spirost-5-en-3-yl 6-deoxy-α-L-mannopyranosyl-(1->3)-[6-deoxy-α-L-mannopyranosyl-(1->2)-6-deoxy-α-L-mannopyranosyl-(1->4)]-β-D-glucopyranoside |
| β-D-Glucopyranoside, (3β,25R)-spirost-5-en-3-yl O-6-deoxy-α-L-mannopyranosyl-(1->3)-O-[O-6-deoxy-α-L-mannopyranosyl-(1->2)-6-deoxy-α-L-mannopyranosyl-(1->4)]- |