4-(4-Isothiocyanatophenylazo)-N,N-dimethylaniline structure
|
Common Name | 4-(4-Isothiocyanatophenylazo)-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 7612-98-8 | Molecular Weight | 282.363 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 466.2±30.0 °C at 760 mmHg | |
| Molecular Formula | C15H14N4S | Melting Point | 167-171 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 235.7±24.6 °C | |
| Symbol |
GHS08 |
Signal Word | Danger | |
Use of 4-(4-Isothiocyanatophenylazo)-N,N-dimethylaniline4-(N,N-Dimethylamino)azobenzene-4'-isothiocyanate is a chromophoric, hydrophobic reagent for probing membrane-buried segments of intrinsic proteins[1]. |
| Name | 4-(n,n-dimethylamino)azobenzene-4'-isothiocyanate |
|---|---|
| Synonym | More Synonyms |
| Description | 4-(N,N-Dimethylamino)azobenzene-4'-isothiocyanate is a chromophoric, hydrophobic reagent for probing membrane-buried segments of intrinsic proteins[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 466.2±30.0 °C at 760 mmHg |
| Melting Point | 167-171 °C(lit.) |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.363 |
| Flash Point | 235.7±24.6 °C |
| Exact Mass | 282.093903 |
| PSA | 72.41000 |
| LogP | 5.95 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | OSWZKAVBSQAVFI-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(N=Nc2ccc(N=C=S)cc2)cc1 |
| Water Solubility | dioxane: 20 mg/mL, clear, red |
| Symbol |
GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H317-H334 |
| Precautionary Statements | P261-P280-P342 + P311 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 42 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | NX9125000 |
| HS Code | 2930909090 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-((4-Isothiocyanatophenyl)azo)-N,N-dimethylaniline |
| 4-[(4-isothiocyanatophenyl)diazenyl]-N,N-dimethylaniline |
| Benzenamine, 4-[(E)-2-(4-isothiocyanatophenyl)diazenyl]-N,N-dimethyl- |
| EINECS 231-521-3 |
| MFCD00004812 |
| 4-[(E)-(4-Isothiocyanatophenyl)diazenyl]-N,N-dimethylaniline |