Mal-PEG1-acid
Modify Date: 2025-09-05 12:14:05
Mal-PEG1-acid structure
|
Common Name | Mal-PEG1-acid | ||
|---|---|---|---|---|
| CAS Number | 760952-64-5 | Molecular Weight | 213.187 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 419.4±30.0 °C at 760 mmHg | |
| Molecular Formula | C9H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.5±24.6 °C | |
Use of Mal-PEG1-acidMal-PEG1-acid is a non-cleavable (1 unit PEG) ADC linker used in the synthesis of antibody-drug conjugates (ADCs) |
| Name | Mal-PEG1-acid |
|---|---|
| Synonym | More Synonyms |
| Description | Mal-PEG1-acid is a non-cleavable (1 unit PEG) ADC linker used in the synthesis of antibody-drug conjugates (ADCs) |
|---|---|
| Related Catalog | |
| Target |
Non-cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 419.4±30.0 °C at 760 mmHg |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.187 |
| Flash Point | 207.5±24.6 °C |
| Exact Mass | 213.063721 |
| LogP | -0.37 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | YTZFUAXOTCJZHP-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCN1C(=O)C=CC1=O |
| Hazard Codes | Xi |
|---|
| 3-[2-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)ethoxy]propanoic acid |
| MFCD24497443 |
| Propanoic acid, 3-[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethoxy]- |