3-(DANSYLAMINO)PHENYLBORONIC ACID
Modify Date: 2025-08-25 23:26:23
3-(DANSYLAMINO)PHENYLBORONIC ACID structure
|
Common Name | 3-(DANSYLAMINO)PHENYLBORONIC ACID | ||
|---|---|---|---|---|
| CAS Number | 75806-94-9 | Molecular Weight | 370.23000 | |
| Density | 1.39g/cm3 | Boiling Point | 599.3ºC at 760 mmHg | |
| Molecular Formula | C18H19BN2O4S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 316.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 3-(DANSYLAMINO)PHENYLBORONIC ACID3-(Dansylamino)phenylboronic acid, a phenylboronic acid derivative, can be used for the glucose detection[1]. |
| Name | [3-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]phenyl]boronic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 3-(Dansylamino)phenylboronic acid, a phenylboronic acid derivative, can be used for the glucose detection[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 599.3ºC at 760 mmHg |
| Molecular Formula | C18H19BN2O4S |
| Molecular Weight | 370.23000 |
| Flash Point | 316.3ºC |
| Exact Mass | 370.11600 |
| PSA | 98.25000 |
| LogP | 2.54020 |
| Index of Refraction | 1.685 |
| InChIKey | TYXMKSYBCDTGDU-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)Nc3cccc(B(O)O)c3)cccc12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36-24/25-22 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Inhibition of subtilisin by substituted arylboronic acids.
FEBS Lett. 133 , 36, (1981)
|
|
|
Synthesis of a fluorescent boronic acid which reversibly binds to cell walls and a diboronic acid which agglutinates erythrocytes.
Biochem. Biophys. Res. Commun. 96 , 157, (1980)
|
|
|
N-(5-dimethylaminonaphthalene-1-sulfonyl)-3-aminobenzene boronic acid as an active-site-directed fluorescent probe of lipoprotein lipase.
Biochim. Biophys. Acta 746(3) , 217-9, (1983) Resonance energy transfer was used to monitor the interaction of an active-site-directed fluorescent inhibitor, N-(5-dimethylaminonaphthalene-1-sulfonyl)-3-aminobenzene boronic acid, and lipoprotein l... |
| m(dansylamidophenyl)boronic acid |
| 3-(Dansylamido)benzeneboronic acid |
| 3-(Dansylamino)phenylboronic acid |