NH2-PEG9-acid structure
|
Common Name | NH2-PEG9-acid | ||
|---|---|---|---|---|
| CAS Number | 756526-04-2 | Molecular Weight | 441.514 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 547.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H39NO10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.7±30.1 °C | |
Use of NH2-PEG9-acidNH2-PEG9-acid is a non-cleavable 9 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | 1-Amino-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | NH2-PEG9-acid is a non-cleavable 9 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Non-cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[2]. |
| References |
[1]. Michael Nathaniel ALONSO, et al. Antibody adjuvant conjugates. WO2018009916A1. |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 547.1±50.0 °C at 760 mmHg |
| Molecular Formula | C19H39NO10 |
| Molecular Weight | 441.514 |
| Flash Point | 284.7±30.1 °C |
| Exact Mass | 441.257385 |
| LogP | -3.36 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.470 |
| InChIKey | YLKOHZCQTVYVDB-UHFFFAOYSA-N |
| SMILES | NCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
| 1-Amino-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oic acid |
| MFCD11041146 |
| 3,6,9,12,15,18,21,24-Octaoxaheptacosan-27-oic acid, 1-amino- |
| H2N-PEG8-COOH |