Mal-amido-PEG4-NHS ester structure
|
Common Name | Mal-amido-PEG4-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 756525-99-2 | Molecular Weight | 513.49500 | |
| Density | 1.36±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H31N3O11 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of Mal-amido-PEG4-NHS esterMal-amido-PEG4-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Mal-amido-PEG4-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.36±0.1 g/cm3 |
|---|---|
| Molecular Formula | C22H31N3O11 |
| Molecular Weight | 513.49500 |
| Exact Mass | 513.19600 |
| PSA | 170.57000 |
| InChIKey | XSRYGQJQNPJNKZ-UHFFFAOYSA-N |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| monodisperse Mal-PEG4-NHS-ester |
| AmbotzPEG1575 |
| Maleimide-PEG4-NHS Ester |