4-[(4-aminophenyl)sulfonylamino]-2-methyl-benzenesulfonic acid structure
|
Common Name | 4-[(4-aminophenyl)sulfonylamino]-2-methyl-benzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 7512-71-2 | Molecular Weight | 342.39100 | |
| Density | 1.557g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(4-aminophenyl)sulfonylamino]-2-methylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.557g/cm3 |
|---|---|
| Molecular Formula | C13H14N2O5S2 |
| Molecular Weight | 342.39100 |
| Exact Mass | 342.03400 |
| PSA | 143.32000 |
| LogP | 4.44050 |
| Index of Refraction | 1.674 |
| InChIKey | DRLLHYSWRGTVRQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)ccc1S(=O)(=O)O |
|
~%
4-[(4-aminophen... CAS#:7512-71-2 |
| Literature: Crossley; Northey; Hultquist Journal of the American Chemical Society, 1938 , vol. 60, p. 2217,2219 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-sulfanilylamino-toluene-2-sulfonic acid |
| 5-Sulfanilylamino-toluol-2-sulfonsaeure |