4-[(4-aminophenyl)methyl]aniline,1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione
Modify Date: 2025-08-25 19:02:33
![4-[(4-aminophenyl)methyl]aniline,1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione Structure](https://image.chemsrc.com/caspic/004/26140-67-0.png)
4-[(4-aminophenyl)methyl]aniline,1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione structure
|
Common Name | 4-[(4-aminophenyl)methyl]aniline,1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 26140-67-0 | Molecular Weight | 556.61100 | |
| Density | N/A | Boiling Point | 584.9ºC at 760mmHg | |
| Molecular Formula | C34H28N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.3ºC | |
| Name | 4-[(4-aminophenyl)methyl]aniline,1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 584.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C34H28N4O4 |
| Molecular Weight | 556.61100 |
| Flash Point | 278.3ºC |
| Exact Mass | 556.21100 |
| PSA | 126.80000 |
| LogP | 5.87040 |
| InChIKey | MFVZRNBIJWOMNC-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Cc2ccc(N)cc2)cc1.O=C1C=CC(=O)N1c1ccc(Cc2ccc(N3C(=O)C=CC3=O)cc2)cc1 |
| ID 93 |
| Kinel 5504 |
| ID 91 |
| Kerimid 601 Resin |
| 4,4'-Bismaleimidodiphenylmethane,polymer with 4,4'-diaminodiphenylmethane |
| 1H-Pyrrole-2,5-dione,1,1'-(methylenedi-4,1-phenylene)bis-,polymer with 4,4'-methylenebis(benzenamine) |