1-methoxy-2-(2-nitrophenoxy)benzene structure
|
Common Name | 1-methoxy-2-(2-nitrophenoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 74865-12-6 | Molecular Weight | 245.23100 | |
| Density | 1.252g/cm3 | Boiling Point | 348ºC at 760mmHg | |
| Molecular Formula | C13H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.7ºC | |
| Name | 1-(2-methoxyphenoxy)-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 348ºC at 760mmHg |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23100 |
| Flash Point | 147.7ºC |
| Exact Mass | 245.06900 |
| PSA | 64.28000 |
| LogP | 3.91890 |
| InChIKey | DFUIXWANLWLQIQ-UHFFFAOYSA-N |
| SMILES | COc1ccccc1Oc1ccccc1[N+](=O)[O-] |
|
~89%
1-methoxy-2-(2-... CAS#:74865-12-6 |
| Literature: UOP Inc. Patent: US4287372 A1, 1981 ; |
|
~%
1-methoxy-2-(2-... CAS#:74865-12-6 |
| Literature: Cullinane; Davey; Padfield Journal of the Chemical Society, 1934 , p. 716,719 Show Details Scarborough; Sweeten Journal of the Chemical Society, 1934 , p. 867 |
| 2-methoxy-2'-nitrodiphenyl ether |
| 1-methoxy-2-(2-nitro-phenoxy)-benzene |
| 1-Methoxy-2-(2-nitro-phenoxy)-benzol |
| O-Methyl-O'-(2-nitro-phenyl)-brenzcatechin |
| HMS544A18 |
| o-Nitrophenyl-o-methoxyphenyl-ether |
| 2'-Nitro-2-methoxy-diphenylaether |
| Brenzcatechin-methylaether-(2-nitro-phenyl)-aether |